C22H31N3O3 — CID 86913191
2-[4-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N,N-diethylacetamide (PubChem CID 86913191) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[4-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 86913191 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[4-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(Cc2cc(=O)oc3cc(C)c(C)cc23)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-5-25(6-2)21(26)15-24-9-7-23(8-10-24)14-18-13-22(27)28-20-12-17(4)16(3)11-19(18)20/h11-13H,5-10,14-15H2,1-4H3 |
| InChIKey | OIMJTNMEGCNGGF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|