C19H21N3O2S — CID 18136600
6,7-dimethyl-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 18136600) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 18136600 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(c4nccs4)CC3)c2cc1C |
| InChI | InChI=1S/C19H21N3O2S/c1-13-9-16-15(11-18(23)24-17(16)10-14(13)2)12-21-4-6-22(7-5-21)19-20-3-8-25-19/h3,8-11H,4-7,12H2,1-2H3 |
| InChIKey | GNOOLGRLKORHMC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|