C15H20N4OS — CID 107208200
3-methoxy-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline (PubChem CID 107208200) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-methoxy-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline.
| Compound Name | 3-methoxy-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 107208200 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-methoxy-4-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline |
| SMILES | COc1cc(N)ccc1CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H20N4OS/c1-20-14-10-13(16)3-2-12(14)11-18-5-7-19(8-6-18)15-17-4-9-21-15/h2-4,9-10H,5-8,11,16H2,1H3 |
| InChIKey | AOXXZCWXRUVQSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|