C14H17FN4S — CID 107347197
2-fluoro-3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline (PubChem CID 107347197) has the molecular formula C14H17FN4S and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-fluoro-3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline.
| Compound Name | 2-fluoro-3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 107347197 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-fluoro-3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]aniline |
| SMILES | Nc1cccc(CN2CCN(c3nccs3)CC2)c1F |
| InChI | InChI=1S/C14H17FN4S/c15-13-11(2-1-3-12(13)16)10-18-5-7-19(8-6-18)14-17-4-9-20-14/h1-4,9H,5-8,10,16H2 |
| InChIKey | YKWPVBVRALQYIM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|