C13H18N6S — CID 62471212
[3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine (PubChem CID 62471212) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is [3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62471212 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [3-[[4-(1,3-thiazol-2-yl)piperazin-1-yl]methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ncccc1CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C13H18N6S/c14-17-12-11(2-1-3-15-12)10-18-5-7-19(8-6-18)13-16-4-9-20-13/h1-4,9H,5-8,10,14H2,(H,15,17) |
| InChIKey | OIJVYQJTSFCZEO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|