C12H21N5O — CID 62470861
2-[4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazin-1-yl]ethanol (PubChem CID 62470861) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 62470861 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)methyl]piperazin-1-yl]ethanol |
| SMILES | NNc1ncccc1CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C12H21N5O/c13-15-12-11(2-1-3-14-12)10-17-6-4-16(5-7-17)8-9-18/h1-3,18H,4-10,13H2,(H,14,15) |
| InChIKey | XFWGTRRBTADHEG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|