C12H21N5O3S — CID 107223459
2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107223459) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107223459 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | NNc1ncccc1S(=O)(=O)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H21N5O3S/c13-15-12-11(3-1-4-14-12)21(19,20)17-6-2-5-16(7-8-17)9-10-18/h1,3-4,18H,2,5-10,13H2,(H,14,15) |
| InChIKey | QZKBSBRNIBBTOD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|