About 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol
2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107223459) has the molecular formula C12H21N5O3S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
| PubChem CID | 107223459 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | NNc1ncccc1S(=O)(=O)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H21N5O3S/c13-15-12-11(3-1-4-14-12)21(19,20)17-6-2-5-16(7-8-17)9-10-18/h1,3-4,18H,2,5-10,13H2,(H,14,15) |
| InChIKey | QZKBSBRNIBBTOD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol?
The IUPAC name of 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol (CID 107223459) is 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol.
What is the SMILES notation for 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol?
The canonical SMILES for 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol is NNc1ncccc1S(=O)(=O)N1CCCN(CCO)CC1.
What is the InChIKey of 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol?
The InChIKey is QZKBSBRNIBBTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O3S/c13-15-12-11(3-1-4-14-12)21(19,20)17-6-2-5-16(7-8-17)9-10-18/h1,3-4,18H,2,5-10,13H2,(H,14,15).
What are the key properties of 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol?
2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol has a molecular weight of 315.40 g/mol, XLogP of -0.94, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol is sourced from PubChem (CID 107223459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).