About 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol
2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 107226271) has the molecular formula C13H22N4O3S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol |
| PubChem CID | 107226271 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | CNc1ncccc1S(=O)(=O)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C13H22N4O3S/c1-14-13-12(4-2-5-15-13)21(19,20)17-7-3-6-16(8-9-17)10-11-18/h2,4-5,18H,3,6-11H2,1H3,(H,14,15) |
| InChIKey | GQQWGWPKSJGAGK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol?
The IUPAC name of 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol (CID 107226271) is 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol.
What is the SMILES notation for 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol?
The canonical SMILES for 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol is CNc1ncccc1S(=O)(=O)N1CCCN(CCO)CC1.
What is the InChIKey of 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol?
The InChIKey is GQQWGWPKSJGAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O3S/c1-14-13-12(4-2-5-15-13)21(19,20)17-7-3-6-16(8-9-17)10-11-18/h2,4-5,18H,3,6-11H2,1H3,(H,14,15).
What are the key properties of 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol?
2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol has a molecular weight of 314.41 g/mol, XLogP of -0.19, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-1-yl]ethanol is sourced from PubChem (CID 107226271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).