C15H25N3O2S — CID 63161871
3-(4,4-diethylpiperidin-1-yl)sulfonyl-N-methylpyridin-2-amine (PubChem CID 63161871) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)sulfonyl-N-methylpyridin-2-amine.
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)sulfonyl-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 63161871 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)sulfonyl-N-methylpyridin-2-amine |
| SMILES | CCC1(CC)CCN(S(=O)(=O)c2cccnc2NC)CC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-4-15(5-2)8-11-18(12-9-15)21(19,20)13-7-6-10-17-14(13)16-3/h6-7,10H,4-5,8-9,11-12H2,1-3H3,(H,16,17) |
| InChIKey | UVDHWBGXJGGODF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |