C11H17N3O4S — CID 81213010
[4-[[2-(methylamino)-3-pyridinyl]sulfonyl]morpholin-2-yl]methanol (PubChem CID 81213010) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is [4-[[2-(methylamino)-3-pyridinyl]sulfonyl]morpholin-2-yl]methanol.
| Compound Name | [4-[[2-(methylamino)-3-pyridinyl]sulfonyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81213010 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [4-[[2-(methylamino)-3-pyridinyl]sulfonyl]morpholin-2-yl]methanol |
| SMILES | CNc1ncccc1S(=O)(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C11H17N3O4S/c1-12-11-10(3-2-4-13-11)19(16,17)14-5-6-18-9(7-14)8-15/h2-4,9,15H,5-8H2,1H3,(H,12,13) |
| InChIKey | MKDGQLYBMLAGKE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |