About N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine
N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine (PubChem CID 62966962) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine |
| PubChem CID | 62966962 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine |
| SMILES | CNc1ncccc1S(=O)(=O)N1CCCOC(C)C1 |
| InChI | InChI=1S/C12H19N3O3S/c1-10-9-15(7-4-8-18-10)19(16,17)11-5-3-6-14-12(11)13-2/h3,5-6,10H,4,7-9H2,1-2H3,(H,13,14) |
| InChIKey | JFTXQBPGPGVRRC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine?
The IUPAC name of N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine (CID 62966962) is N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine.
What is the SMILES notation for N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine?
The canonical SMILES for N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine is CNc1ncccc1S(=O)(=O)N1CCCOC(C)C1.
What is the InChIKey of N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine?
The InChIKey is JFTXQBPGPGVRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-10-9-15(7-4-8-18-10)19(16,17)11-5-3-6-14-12(11)13-2/h3,5-6,10H,4,7-9H2,1-2H3,(H,13,14).
What are the key properties of N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine?
N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine has a molecular weight of 285.37 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyridin-2-amine is sourced from PubChem (CID 62966962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).