C12H16N2O4S2 — CID 81202964
2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylbenzenecarbothioamide (PubChem CID 81202964) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylbenzenecarbothioamide.
| Compound Name | 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylbenzenecarbothioamide |
|---|---|
| PubChem CID | 81202964 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylbenzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1S(=O)(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C12H16N2O4S2/c13-12(19)10-3-1-2-4-11(10)20(16,17)14-5-6-18-9(7-14)8-15/h1-4,9,15H,5-8H2,(H2,13,19) |
| InChIKey | IWTGRQLAKGPPKM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|