C7H14N2O4S2 — CID 81203136
2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylethanethioamide (PubChem CID 81203136) has the molecular formula C7H14N2O4S2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylethanethioamide.
| Compound Name | 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylethanethioamide |
|---|---|
| PubChem CID | 81203136 |
| Molecular Formula | C7H14N2O4S2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-[2-(hydroxymethyl)morpholin-4-yl]sulfonylethanethioamide |
| SMILES | NC(=S)CS(=O)(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C7H14N2O4S2/c8-7(14)5-15(11,12)9-1-2-13-6(3-9)4-10/h6,10H,1-5H2,(H2,8,14) |
| InChIKey | LJIPIGUHTNVXSX-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|