C8H16N2O3S2 — CID 114797660
2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]sulfonylethanethioamide (PubChem CID 114797660) has the molecular formula C8H16N2O3S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]sulfonylethanethioamide.
| Compound Name | 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]sulfonylethanethioamide |
|---|---|
| PubChem CID | 114797660 |
| Molecular Formula | C8H16N2O3S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)pyrrolidin-1-yl]sulfonylethanethioamide |
| SMILES | NC(=S)CS(=O)(=O)N1CCC(CCO)C1 |
| InChI | InChI=1S/C8H16N2O3S2/c9-8(14)6-15(12,13)10-3-1-7(5-10)2-4-11/h7,11H,1-6H2,(H2,9,14) |
| InChIKey | CYFUHOGKXCFOOY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|