C12H26N2O3S — CID 115744998
3-(2-hydroxyethyl)-N,N-dipropylpyrrolidine-1-sulfonamide (PubChem CID 115744998) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-N,N-dipropylpyrrolidine-1-sulfonamide.
| Compound Name | 3-(2-hydroxyethyl)-N,N-dipropylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 115744998 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-(2-hydroxyethyl)-N,N-dipropylpyrrolidine-1-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)N1CCC(CCO)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-3-7-13(8-4-2)18(16,17)14-9-5-12(11-14)6-10-15/h12,15H,3-11H2,1-2H3 |
| InChIKey | DKKGYOFKXUUPRZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |