C11H24N2O3S — CID 43502985
3-hydroxy-N,N-dipropylpiperidine-1-sulfonamide (PubChem CID 43502985) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 3-hydroxy-N,N-dipropylpiperidine-1-sulfonamide.
| Compound Name | 3-hydroxy-N,N-dipropylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43502985 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-hydroxy-N,N-dipropylpiperidine-1-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C11H24N2O3S/c1-3-7-12(8-4-2)17(15,16)13-9-5-6-11(14)10-13/h11,14H,3-10H2,1-2H3 |
| InChIKey | PKQGGRGWFPLICG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |