C10H14N2O5S — CID 81208935
3-[2-(hydroxymethyl)morpholin-4-yl]sulfonyl-1H-pyridin-4-one (PubChem CID 81208935) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)morpholin-4-yl]sulfonyl-1H-pyridin-4-one.
| Compound Name | 3-[2-(hydroxymethyl)morpholin-4-yl]sulfonyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 81208935 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-[2-(hydroxymethyl)morpholin-4-yl]sulfonyl-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]cc1S(=O)(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C10H14N2O5S/c13-7-8-6-12(3-4-17-8)18(15,16)10-5-11-2-1-9(10)14/h1-2,5,8,13H,3-4,6-7H2,(H,11,14) |
| InChIKey | LOSVQVIQSOVQPX-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |