C8H13N3O4S — CID 102693223
[4-(1H-pyrazol-5-ylsulfonyl)morpholin-2-yl]methanol (PubChem CID 102693223) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is [4-(1H-pyrazol-5-ylsulfonyl)morpholin-2-yl]methanol.
| Compound Name | [4-(1H-pyrazol-5-ylsulfonyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102693223 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [4-(1H-pyrazol-5-ylsulfonyl)morpholin-2-yl]methanol |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCOC(CO)C1 |
| InChI | InChI=1S/C8H13N3O4S/c12-6-7-5-11(3-4-15-7)16(13,14)8-1-2-9-10-8/h1-2,7,12H,3-6H2,(H,9,10) |
| InChIKey | XMNOIJQKSXGKLC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |