C11H15ClN2O4S — CID 81206052
[4-(4-amino-2-chlorophenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 81206052) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is [4-(4-amino-2-chlorophenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-amino-2-chlorophenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81206052 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | [4-(4-amino-2-chlorophenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | Nc1ccc(S(=O)(=O)N2CCOC(CO)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O4S/c12-10-5-8(13)1-2-11(10)19(16,17)14-3-4-18-9(6-14)7-15/h1-2,5,9,15H,3-4,6-7,13H2 |
| InChIKey | BHTQTTYBIKNCRM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|