C11H16N2O5S — CID 102934020
3-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonyl-1H-pyridin-4-one (PubChem CID 102934020) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonyl-1H-pyridin-4-one.
| Compound Name | 3-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 102934020 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonyl-1H-pyridin-4-one |
| SMILES | CC1CN(S(=O)(=O)c2c[nH]ccc2=O)CC(CO)O1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8-5-13(6-9(7-14)18-8)19(16,17)11-4-12-3-2-10(11)15/h2-4,8-9,14H,5-7H2,1H3,(H,12,15) |
| InChIKey | SYNGTYLRPCYPSQ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |