C13H15ClN2O4S — CID 102932852
3-chloro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonylbenzonitrile (PubChem CID 102932852) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 3-chloro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonylbenzonitrile.
| Compound Name | 3-chloro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 102932852 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-chloro-4-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]sulfonylbenzonitrile |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C#N)cc2Cl)CC(CO)O1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-9-6-16(7-11(8-17)20-9)21(18,19)13-3-2-10(5-15)4-12(13)14/h2-4,9,11,17H,6-8H2,1H3 |
| InChIKey | VGZBLFJNCWLECC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |