C11H14BrClN2O4S — CID 102932488
[4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-6-methylmorpholin-2-yl]methanol (PubChem CID 102932488) has the molecular formula C11H14BrClN2O4S and a molecular weight of 385.67 g/mol. Its IUPAC name is [4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102932488 |
| Molecular Formula | C11H14BrClN2O4S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | [4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(S(=O)(=O)c2cc(Br)cnc2Cl)CC(CO)O1 |
| InChI | InChI=1S/C11H14BrClN2O4S/c1-7-4-15(5-9(6-16)19-7)20(17,18)10-2-8(12)3-14-11(10)13/h2-3,7,9,16H,4-6H2,1H3 |
| InChIKey | WCFOIAOOQIJFCI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|