C11H14BrClN2O3S — CID 103931384
(2S,6R)-4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,6-dimethylmorpholine (PubChem CID 103931384) has the molecular formula C11H14BrClN2O3S and a molecular weight of 369.67 g/mol. Its IUPAC name is (2S,6R)-4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 103931384 |
| Molecular Formula | C11H14BrClN2O3S |
| Molecular Weight | 369.67 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | (2S,6R)-4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(Br)cnc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C11H14BrClN2O3S/c1-7-5-15(6-8(2)18-7)19(16,17)10-3-9(12)4-14-11(10)13/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | PENZEZFUYASROV-OCAPTIKFSA-N |
| XLogP | 2.30 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|