About 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine
4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 47257434) has the molecular formula C12H15Br2NO3S
and a molecular weight of 413.13 g/mol. Its IUPAC name is 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine |
| PubChem CID | 47257434 |
| Molecular Formula | C12H15Br2NO3S |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Br)cc2Br)CC(C)O1 |
| InChI | InChI=1S/C12H15Br2NO3S/c1-8-6-15(7-9(2)18-8)19(16,17)12-4-3-10(13)5-11(12)14/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | RJROQVQPXSRMMD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine?
The IUPAC name of 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine (CID 47257434) is 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine?
The canonical SMILES for 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine is CC1CN(S(=O)(=O)c2ccc(Br)cc2Br)CC(C)O1.
What is the InChIKey of 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine?
The InChIKey is RJROQVQPXSRMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Br2NO3S/c1-8-6-15(7-9(2)18-8)19(16,17)12-4-3-10(13)5-11(12)14/h3-5,8-9H,6-7H2,1-2H3.
What are the key properties of 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine?
4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine has a molecular weight of 413.13 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dibromophenyl)sulfonyl-2,6-dimethylmorpholine is sourced from PubChem (CID 47257434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).