C12H14Br2FNO3S — CID 102938147
4-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)-6-methylmorpholine (PubChem CID 102938147) has the molecular formula C12H14Br2FNO3S and a molecular weight of 431.12 g/mol. Its IUPAC name is 4-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)-6-methylmorpholine.
| Compound Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 102938147 |
| Molecular Formula | C12H14Br2FNO3S |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-2-(bromomethyl)-6-methylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Br)cc2F)CC(CBr)O1 |
| InChI | InChI=1S/C12H14Br2FNO3S/c1-8-6-16(7-10(5-13)19-8)20(17,18)12-3-2-9(14)4-11(12)15/h2-4,8,10H,5-7H2,1H3 |
| InChIKey | NQVRAPSHKDCNFM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|