C15H20BrNO3S — CID 102938133
2-(bromomethyl)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-6-methylmorpholine (PubChem CID 102938133) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-6-methylmorpholine.
| Compound Name | 2-(bromomethyl)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 102938133 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-(bromomethyl)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-6-methylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)CCC3)CC(CBr)O1 |
| InChI | InChI=1S/C15H20BrNO3S/c1-11-9-17(10-14(8-16)20-11)21(18,19)15-6-5-12-3-2-4-13(12)7-15/h5-7,11,14H,2-4,8-10H2,1H3 |
| InChIKey | RIVPCUOQGXGBMI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|