C14H20ClNO3S — CID 102938072
2-(chloromethyl)-4-(3,4-dimethylphenyl)sulfonyl-6-methylmorpholine (PubChem CID 102938072) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3,4-dimethylphenyl)sulfonyl-6-methylmorpholine.
| Compound Name | 2-(chloromethyl)-4-(3,4-dimethylphenyl)sulfonyl-6-methylmorpholine |
|---|---|
| PubChem CID | 102938072 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(chloromethyl)-4-(3,4-dimethylphenyl)sulfonyl-6-methylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)OC(CCl)C2)cc1C |
| InChI | InChI=1S/C14H20ClNO3S/c1-10-4-5-14(6-11(10)2)20(17,18)16-8-12(3)19-13(7-15)9-16/h4-6,12-13H,7-9H2,1-3H3 |
| InChIKey | JYXRXMXZERMJAL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|