C26H34N2O8S3 — CID 124913875
2,9-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5,6-dihydrobenzo[b][1]benzothiepine 11,11-dioxide (PubChem CID 124913875) has the molecular formula C26H34N2O8S3 and a molecular weight of 598.77 g/mol. Its IUPAC name is 2,9-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5,6-dihydrobenzo[b][1]benzothiepine 11,11-dioxide.
| Compound Name | 2,9-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5,6-dihydrobenzo[b][1]benzothiepine 11,11-dioxide |
|---|---|
| PubChem CID | 124913875 |
| Molecular Formula | C26H34N2O8S3 |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 2,9-bis[[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl]-5,6-dihydrobenzo[b][1]benzothiepine 11,11-dioxide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc3c(c2)S(=O)(=O)c2cc(S(=O)(=O)N4C[C@@H](C)O[C@@H](C)C4)ccc2CC3)C[C@H](C)O1 |
| InChI | InChI=1S/C26H34N2O8S3/c1-17-13-27(14-18(2)35-17)38(31,32)23-9-7-21-5-6-22-8-10-24(12-26(22)37(29,30)25(21)11-23)39(33,34)28-15-19(3)36-20(4)16-28/h7-12,17-20H,5-6,13-16H2,1-4H3/t17-,18+,19-,20+ |
| InChIKey | ZLETZNDTIZHQDN-FGYAAKKASA-N |
| XLogP | 2.21 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |