C11H11BrFNO3S — CID 116528601
1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylpyrrolidin-2-one (PubChem CID 116528601) has the molecular formula C11H11BrFNO3S and a molecular weight of 336.18 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylpyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 116528601 |
| Molecular Formula | C11H11BrFNO3S |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)N(S(=O)(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C11H11BrFNO3S/c1-7-4-11(15)14(6-7)18(16,17)10-3-2-8(12)5-9(10)13/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | ZIDGRFXVPSGZOQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |