C11H10BrCl2NO3S — CID 63100893
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-methylpyrrolidin-2-one (PubChem CID 63100893) has the molecular formula C11H10BrCl2NO3S and a molecular weight of 387.08 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-methylpyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 63100893 |
| Molecular Formula | C11H10BrCl2NO3S |
| Molecular Weight | 387.08 g/mol |
| Exact Mass | 384.89 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)N(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C11H10BrCl2NO3S/c1-6-2-10(16)15(5-6)19(17,18)11-8(13)3-7(12)4-9(11)14/h3-4,6H,2,5H2,1H3 |
| InChIKey | CXWPQADOPDHGTI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |