C12H15BrCl2N2O2S — CID 63872723
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperazine (PubChem CID 63872723) has the molecular formula C12H15BrCl2N2O2S and a molecular weight of 402.14 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperazine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 63872723 |
| Molecular Formula | C12H15BrCl2N2O2S |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)CC(C)N1 |
| InChI | InChI=1S/C12H15BrCl2N2O2S/c1-7-5-17(6-8(2)16-7)20(18,19)12-10(14)3-9(13)4-11(12)15/h3-4,7-8,16H,5-6H2,1-2H3 |
| InChIKey | STQVTHOYTHCPGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |