C13H16BrCl2NO3S — CID 63980191
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(methoxymethyl)piperidine (PubChem CID 63980191) has the molecular formula C13H16BrCl2NO3S and a molecular weight of 417.15 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(methoxymethyl)piperidine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(methoxymethyl)piperidine |
|---|---|
| PubChem CID | 63980191 |
| Molecular Formula | C13H16BrCl2NO3S |
| Molecular Weight | 417.15 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(methoxymethyl)piperidine |
| SMILES | COCC1CCN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C13H16BrCl2NO3S/c1-20-8-9-2-4-17(5-3-9)21(18,19)13-11(15)6-10(14)7-12(13)16/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | OWWSIBDNJSDHHC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |