C13H18Cl2N2O3S — CID 106585755
3,5-dichloro-4-[3-(methoxymethyl)piperidin-1-yl]sulfonylaniline (PubChem CID 106585755) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 3,5-dichloro-4-[3-(methoxymethyl)piperidin-1-yl]sulfonylaniline.
| Compound Name | 3,5-dichloro-4-[3-(methoxymethyl)piperidin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 106585755 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3,5-dichloro-4-[3-(methoxymethyl)piperidin-1-yl]sulfonylaniline |
| SMILES | COCC1CCCN(S(=O)(=O)c2c(Cl)cc(N)cc2Cl)C1 |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-20-8-9-3-2-4-17(7-9)21(18,19)13-11(14)5-10(16)6-12(13)15/h5-6,9H,2-4,7-8,16H2,1H3 |
| InChIKey | UPDYLMXLMOKRTF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|