C13H17Cl2N3O2S — CID 61105694
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-3,5-dichloroaniline (PubChem CID 61105694) has the molecular formula C13H17Cl2N3O2S and a molecular weight of 350.27 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-3,5-dichloroaniline.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 61105694 |
| Molecular Formula | C13H17Cl2N3O2S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-3,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)N2CCN3CCCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O2S/c14-11-6-9(16)7-12(15)13(11)21(19,20)18-5-4-17-3-1-2-10(17)8-18/h6-7,10H,1-5,8,16H2 |
| InChIKey | VZFVMHDVNYCKBI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|