C13H17ClFN3O2S — CID 103050808
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-5-chloro-2-fluoroaniline (PubChem CID 103050808) has the molecular formula C13H17ClFN3O2S and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-5-chloro-2-fluoroaniline.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-5-chloro-2-fluoroaniline |
|---|---|
| PubChem CID | 103050808 |
| Molecular Formula | C13H17ClFN3O2S |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-5-chloro-2-fluoroaniline |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)N2CCN3CCCC3C2)c1F |
| InChI | InChI=1S/C13H17ClFN3O2S/c14-9-6-11(16)13(15)12(7-9)21(19,20)18-5-4-17-3-1-2-10(17)8-18/h6-7,10H,1-5,8,16H2 |
| InChIKey | RGKAHSVDWGDBTH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|