C14H20BrN3O2S — CID 61104944
4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-3-bromoaniline (PubChem CID 61104944) has the molecular formula C14H20BrN3O2S and a molecular weight of 374.30 g/mol. Its IUPAC name is 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-3-bromoaniline.
| Compound Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-3-bromoaniline |
|---|---|
| PubChem CID | 61104944 |
| Molecular Formula | C14H20BrN3O2S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-3-bromoaniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCN3CCCCC3C2)c(Br)c1 |
| InChI | InChI=1S/C14H20BrN3O2S/c15-13-9-11(16)4-5-14(13)21(19,20)18-8-7-17-6-2-1-3-12(17)10-18/h4-5,9,12H,1-3,6-8,10,16H2 |
| InChIKey | NQQDFNMUJUMMGA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|