C13H17BrClN3O2S — CID 61073342
2-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 61073342) has the molecular formula C13H17BrClN3O2S and a molecular weight of 394.72 g/mol. Its IUPAC name is 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 61073342 |
| Molecular Formula | C13H17BrClN3O2S |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1cc(Br)cnc1Cl)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H17BrClN3O2S/c14-10-7-12(13(15)16-8-10)21(19,20)18-6-5-17-4-2-1-3-11(17)9-18/h7-8,11H,1-6,9H2 |
| InChIKey | OEMUGYLDVQJAMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|