C9H10BrClN2O3S2 — CID 54975156
4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,4-thiazinane 1-oxide (PubChem CID 54975156) has the molecular formula C9H10BrClN2O3S2 and a molecular weight of 373.68 g/mol. Its IUPAC name is 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 54975156 |
| Molecular Formula | C9H10BrClN2O3S2 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(S(=O)(=O)c2cc(Br)cnc2Cl)CC1 |
| InChI | InChI=1S/C9H10BrClN2O3S2/c10-7-5-8(9(11)12-6-7)18(15,16)13-1-3-17(14)4-2-13/h5-6H,1-4H2 |
| InChIKey | RLZVBVQSYCGEJZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|