C14H18BrClN2O3S — CID 166416203
7-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2-methoxy-7-azaspiro[3.5]nonane (PubChem CID 166416203) has the molecular formula C14H18BrClN2O3S and a molecular weight of 409.73 g/mol. Its IUPAC name is 7-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2-methoxy-7-azaspiro[3.5]nonane.
| Compound Name | 7-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2-methoxy-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 166416203 |
| Molecular Formula | C14H18BrClN2O3S |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 7-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2-methoxy-7-azaspiro[3.5]nonane |
| SMILES | COC1CC2(CCN(S(=O)(=O)c3cc(Br)cnc3Cl)CC2)C1 |
| InChI | InChI=1S/C14H18BrClN2O3S/c1-21-11-7-14(8-11)2-4-18(5-3-14)22(19,20)12-6-10(15)9-17-13(12)16/h6,9,11H,2-5,7-8H2,1H3 |
| InChIKey | WDEVPWFUSKRJOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|