C13H18BrClN2O2S2 — CID 79920402
2-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79920402) has the molecular formula C13H18BrClN2O2S2 and a molecular weight of 413.79 g/mol. Its IUPAC name is 2-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79920402 |
| Molecular Formula | C13H18BrClN2O2S2 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 2-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1cc(CCl)sc1Br)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H18BrClN2O2S2/c14-13-12(7-11(8-15)20-13)21(18,19)17-6-5-16-4-2-1-3-10(16)9-17/h7,10H,1-6,8-9H2 |
| InChIKey | MLHCAJPDMUFCQC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|