C8H15ClN2O2S — CID 115649520
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-sulfonyl chloride (PubChem CID 115649520) has the molecular formula C8H15ClN2O2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-sulfonyl chloride.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 115649520 |
| Molecular Formula | C8H15ClN2O2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C8H15ClN2O2S/c9-14(12,13)11-6-5-10-4-2-1-3-8(10)7-11/h8H,1-7H2 |
| InChIKey | MOSZBMGVUZXGFL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |