C11H20N2O3S — CID 129461062
(8aS)-2-[(3S)-oxolan-3-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 129461062) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is (8aS)-2-[(3S)-oxolan-3-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-[(3S)-oxolan-3-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 129461062 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (8aS)-2-[(3S)-oxolan-3-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=S(=O)([C@H]1CCOC1)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C11H20N2O3S/c14-17(15,11-3-7-16-9-11)13-6-5-12-4-1-2-10(12)8-13/h10-11H,1-9H2/t10-,11-/m0/s1 |
| InChIKey | LPXICDKKMOXWKN-QWRGUYRKSA-N |
| XLogP | -0.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |