C13H19ClN2O2S2 — CID 79936333
2-[5-(chloromethyl)-4-methylthiophen-2-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79936333) has the molecular formula C13H19ClN2O2S2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-4-methylthiophen-2-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[5-(chloromethyl)-4-methylthiophen-2-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79936333 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[5-(chloromethyl)-4-methylthiophen-2-yl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN3CCCC3C2)sc1CCl |
| InChI | InChI=1S/C13H19ClN2O2S2/c1-10-7-13(19-12(10)8-14)20(17,18)16-6-5-15-4-2-3-11(15)9-16/h7,11H,2-6,8-9H2,1H3 |
| InChIKey | FXCYIXZFXLHFRB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|