C13H21ClN4O2S — CID 79920179
2-[1-(2-chloroethyl)pyrazol-4-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79920179) has the molecular formula C13H21ClN4O2S and a molecular weight of 332.86 g/mol. Its IUPAC name is 2-[1-(2-chloroethyl)pyrazol-4-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[1-(2-chloroethyl)pyrazol-4-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79920179 |
| Molecular Formula | C13H21ClN4O2S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[1-(2-chloroethyl)pyrazol-4-yl]sulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1cnn(CCCl)c1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H21ClN4O2S/c14-4-6-17-11-13(9-15-17)21(19,20)18-8-7-16-5-2-1-3-12(16)10-18/h9,11-12H,1-8,10H2 |
| InChIKey | QWGNECDIRCDARK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|