C12H16Cl2N2O3S — CID 43257069
3,5-dichloro-4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline (PubChem CID 43257069) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is 3,5-dichloro-4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline.
| Compound Name | 3,5-dichloro-4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline |
|---|---|
| PubChem CID | 43257069 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3,5-dichloro-4-(2,6-dimethylmorpholin-4-yl)sulfonylaniline |
| SMILES | CC1CN(S(=O)(=O)c2c(Cl)cc(N)cc2Cl)CC(C)O1 |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-7-5-16(6-8(2)19-7)20(17,18)12-10(13)3-9(15)4-11(12)14/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | MEIQDDYNUOKEAJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|