C12H13BrCl3NO2S — CID 63400747
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(chloromethyl)piperidine (PubChem CID 63400747) has the molecular formula C12H13BrCl3NO2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(chloromethyl)piperidine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(chloromethyl)piperidine |
|---|---|
| PubChem CID | 63400747 |
| Molecular Formula | C12H13BrCl3NO2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-(chloromethyl)piperidine |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCC(CCl)CC1 |
| InChI | InChI=1S/C12H13BrCl3NO2S/c13-9-5-10(15)12(11(16)6-9)20(18,19)17-3-1-8(7-14)2-4-17/h5-6,8H,1-4,7H2 |
| InChIKey | LVMAGUYXIULVAK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|