C13H14BrCl2NO2S — CID 115561154
2-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 115561154) has the molecular formula C13H14BrCl2NO2S and a molecular weight of 399.14 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 115561154 |
| Molecular Formula | C13H14BrCl2NO2S |
| Molecular Weight | 399.14 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 2-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CC2CCCC2C1 |
| InChI | InChI=1S/C13H14BrCl2NO2S/c14-10-4-11(15)13(12(16)5-10)20(18,19)17-6-8-2-1-3-9(8)7-17/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | UKTRGJDYWVNNAG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |