C13H17BrCl2N2O2S — CID 63900099
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-N,N-dimethylpiperidin-3-amine (PubChem CID 63900099) has the molecular formula C13H17BrCl2N2O2S and a molecular weight of 416.17 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-N,N-dimethylpiperidin-3-amine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 63900099 |
| Molecular Formula | C13H17BrCl2N2O2S |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-N,N-dimethylpiperidin-3-amine |
| SMILES | CN(C)C1CCCN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C13H17BrCl2N2O2S/c1-17(2)10-4-3-5-18(8-10)21(19,20)13-11(15)6-9(14)7-12(13)16/h6-7,10H,3-5,8H2,1-2H3 |
| InChIKey | XVBIHYREBSBLKY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |