C11H11Br2Cl2NO2S — CID 80675380
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3-(bromomethyl)pyrrolidine (PubChem CID 80675380) has the molecular formula C11H11Br2Cl2NO2S and a molecular weight of 452.00 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3-(bromomethyl)pyrrolidine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3-(bromomethyl)pyrrolidine |
|---|---|
| PubChem CID | 80675380 |
| Molecular Formula | C11H11Br2Cl2NO2S |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 448.83 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3-(bromomethyl)pyrrolidine |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCC(CBr)C1 |
| InChI | InChI=1S/C11H11Br2Cl2NO2S/c12-5-7-1-2-16(6-7)19(17,18)11-9(14)3-8(13)4-10(11)15/h3-4,7H,1-2,5-6H2 |
| InChIKey | WJOCGEPSMJRCRS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|