C12H13Br2NO3S — CID 81423253
1-(2,5-dibromo-4-methylphenyl)sulfonyl-4-methylpyrrolidin-2-one (PubChem CID 81423253) has the molecular formula C12H13Br2NO3S and a molecular weight of 411.12 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)sulfonyl-4-methylpyrrolidin-2-one.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)sulfonyl-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 81423253 |
| Molecular Formula | C12H13Br2NO3S |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)sulfonyl-4-methylpyrrolidin-2-one |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2CC(C)CC2=O)cc1Br |
| InChI | InChI=1S/C12H13Br2NO3S/c1-7-3-12(16)15(6-7)19(17,18)11-5-9(13)8(2)4-10(11)14/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | FQCPPDZTEKUKRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |